C29H38N4O4S — CID 66586630
[2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl (2S)-2-(1,4-diazepane-1-carbonyl)-4-methylpyrrolidine-1-carboxylate (PubChem CID 66586630) has the molecular formula C29H38N4O4S and a molecular weight of 538.71 g/mol. Its IUPAC name is [2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl (2S)-2-(1,4-diazepane-1-carbonyl)-4-methylpyrrolidine-1-carboxylate.
| Compound Name | [2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl (2S)-2-(1,4-diazepane-1-carbonyl)-4-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66586630 |
| Molecular Formula | C29H38N4O4S |
| Molecular Weight | 538.71 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | [2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl (2S)-2-(1,4-diazepane-1-carbonyl)-4-methylpyrrolidine-1-carboxylate |
| SMILES | Cc1cc(C(=O)N2CCCCc3sccc32)ccc1COC(=O)N1CC(C)C[C@H]1C(=O)N1CCCNCC1 |
| InChI | InChI=1S/C29H38N4O4S/c1-20-16-25(28(35)31-12-5-10-30-11-14-31)33(18-20)29(36)37-19-23-8-7-22(17-21(23)2)27(34)32-13-4-3-6-26-24(32)9-15-38-26/h7-9,15,17,20,25,30H,3-6,10-14,16,18-19H2,1-2H3/t20?,25-/m0/s1 |
| InChIKey | GXPFAXGRCRNGKI-KUXBLMNESA-N |
| XLogP | 4.21 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.71 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |