C29H37N5O3S2 — CID 87273766
(2R)-2-(4-methyl-1,4-diazepane-1-carbonyl)-N-[[2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]-3-sulfanylidenepyrrolidine-1-carboxamide (PubChem CID 87273766) has the molecular formula C29H37N5O3S2 and a molecular weight of 567.78 g/mol. Its IUPAC name is (2R)-2-(4-methyl-1,4-diazepane-1-carbonyl)-N-[[2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]-3-sulfanylidenepyrrolidine-1-carboxamide.
| Compound Name | (2R)-2-(4-methyl-1,4-diazepane-1-carbonyl)-N-[[2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]-3-sulfanylidenepyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87273766 |
| Molecular Formula | C29H37N5O3S2 |
| Molecular Weight | 567.78 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | (2R)-2-(4-methyl-1,4-diazepane-1-carbonyl)-N-[[2-methyl-4-(5,6,7,8-tetrahydrothieno[3,2-b]azepine-4-carbonyl)phenyl]methyl]-3-sulfanylidenepyrrolidine-1-carboxamide |
| SMILES | Cc1cc(C(=O)N2CCCCc3sccc32)ccc1CNC(=O)N1CCC(=S)[C@H]1C(=O)N1CCCN(C)CC1 |
| InChI | InChI=1S/C29H37N5O3S2/c1-20-18-21(27(35)33-13-4-3-6-25-23(33)10-17-39-25)7-8-22(20)19-30-29(37)34-14-9-24(38)26(34)28(36)32-12-5-11-31(2)15-16-32/h7-8,10,17-18,26H,3-6,9,11-16,19H2,1-2H3,(H,30,37)/t26-/m0/s1 |
| InChIKey | RGMHEJQBUYXHKQ-SANMLTNESA-N |
| XLogP | 3.86 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.78 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|