C22H35N3O5S2 — CID 66590746
tert-butyl N-[1-[[(3aR,4S,6aS)-2-thiophen-2-ylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-N-methylcarbamate (PubChem CID 66590746) has the molecular formula C22H35N3O5S2 and a molecular weight of 485.67 g/mol. Its IUPAC name is tert-butyl N-[1-[[(3aR,4S,6aS)-2-thiophen-2-ylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[1-[[(3aR,4S,6aS)-2-thiophen-2-ylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 66590746 |
| Molecular Formula | C22H35N3O5S2 |
| Molecular Weight | 485.67 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | tert-butyl N-[1-[[(3aR,4S,6aS)-2-thiophen-2-ylsulfonyl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-4-yl]amino]-1-oxopentan-2-yl]-N-methylcarbamate |
| SMILES | CCCC(C(=O)N[C@H]1CC[C@@H]2CN(S(=O)(=O)c3cccs3)C[C@@H]21)N(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H35N3O5S2/c1-6-8-18(24(5)21(27)30-22(2,3)4)20(26)23-17-11-10-15-13-25(14-16(15)17)32(28,29)19-9-7-12-31-19/h7,9,12,15-18H,6,8,10-11,13-14H2,1-5H3,(H,23,26)/t15-,16+,17+,18?/m1/s1 |
| InChIKey | BBEFHDNZTYXGGO-KKSQLVLISA-N |
| XLogP | 3.30 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.67 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |