C25H30ClFN2O4 — CID 66591030
2-[2-[3-[(3-fluorophenyl)methoxy]phenyl]ethyl-(furan-2-ylmethyl)amino]-N-(2-methoxyethyl)acetamide;hydrochloride (PubChem CID 66591030) has the molecular formula C25H30ClFN2O4 and a molecular weight of 476.98 g/mol. Its IUPAC name is 2-[2-[3-[(3-fluorophenyl)methoxy]phenyl]ethyl-(furan-2-ylmethyl)amino]-N-(2-methoxyethyl)acetamide;hydrochloride.
| Compound Name | 2-[2-[3-[(3-fluorophenyl)methoxy]phenyl]ethyl-(furan-2-ylmethyl)amino]-N-(2-methoxyethyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 66591030 |
| Molecular Formula | C25H30ClFN2O4 |
| Molecular Weight | 476.98 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | 2-[2-[3-[(3-fluorophenyl)methoxy]phenyl]ethyl-(furan-2-ylmethyl)amino]-N-(2-methoxyethyl)acetamide;hydrochloride |
| SMILES | COCCNC(=O)CN(CCc1cccc(OCc2cccc(F)c2)c1)Cc1ccco1.Cl |
| InChI | InChI=1S/C25H29FN2O4.ClH/c1-30-14-11-27-25(29)18-28(17-24-9-4-13-31-24)12-10-20-5-3-8-23(16-20)32-19-21-6-2-7-22(26)15-21;/h2-9,13,15-16H,10-12,14,17-19H2,1H3,(H,27,29);1H |
| InChIKey | OQKPOWAPXIZBBY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.98 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|