C29H40N8O3Si — CID 66591312
4-[5-(6-amino-5-methoxy-3-pyridinyl)-2-tert-butyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-N-(2-methoxy-4-pyridinyl)pyrimidin-2-amine (PubChem CID 66591312) has the molecular formula C29H40N8O3Si and a molecular weight of 576.78 g/mol. Its IUPAC name is 4-[5-(6-amino-5-methoxy-3-pyridinyl)-2-tert-butyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-N-(2-methoxy-4-pyridinyl)pyrimidin-2-amine.
| Compound Name | 4-[5-(6-amino-5-methoxy-3-pyridinyl)-2-tert-butyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-N-(2-methoxy-4-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66591312 |
| Molecular Formula | C29H40N8O3Si |
| Molecular Weight | 576.78 g/mol |
| Exact Mass | 576.30 |
| IUPAC Name | 4-[5-(6-amino-5-methoxy-3-pyridinyl)-2-tert-butyl-3-(2-trimethylsilylethoxymethyl)imidazol-4-yl]-N-(2-methoxy-4-pyridinyl)pyrimidin-2-amine |
| SMILES | COc1cc(Nc2nccc(-c3c(-c4cnc(N)c(OC)c4)nc(C(C)(C)C)n3COCC[Si](C)(C)C)n2)ccn1 |
| InChI | InChI=1S/C29H40N8O3Si/c1-29(2,3)27-36-24(19-15-22(38-4)26(30)33-17-19)25(37(27)18-40-13-14-41(6,7)8)21-10-12-32-28(35-21)34-20-9-11-31-23(16-20)39-5/h9-12,15-17H,13-14,18H2,1-8H3,(H2,30,33)(H,31,32,34,35) |
| InChIKey | IMWZTPUKRQCIGO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 135.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.78 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|