C18H29NO2 — CID 66600004
2-(3,5-dibutylphenyl)propan-2-yl carbamate (PubChem CID 66600004) has the molecular formula C18H29NO2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 2-(3,5-dibutylphenyl)propan-2-yl carbamate.
| Compound Name | 2-(3,5-dibutylphenyl)propan-2-yl carbamate |
|---|---|
| PubChem CID | 66600004 |
| Molecular Formula | C18H29NO2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 2-(3,5-dibutylphenyl)propan-2-yl carbamate |
| SMILES | CCCCc1cc(CCCC)cc(C(C)(C)OC(N)=O)c1 |
| InChI | InChI=1S/C18H29NO2/c1-5-7-9-14-11-15(10-8-6-2)13-16(12-14)18(3,4)21-17(19)20/h11-13H,5-10H2,1-4H3,(H2,19,20) |
| InChIKey | APNGJRRMWZTSQH-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |