C22H20N4O4S — CID 66604540
7-morpholin-4-ylsulfonyl-2-phenyl-5H-pyrido[3,2-b]indole-4-carboxamide (PubChem CID 66604540) has the molecular formula C22H20N4O4S and a molecular weight of 436.49 g/mol. Its IUPAC name is 7-morpholin-4-ylsulfonyl-2-phenyl-5H-pyrido[3,2-b]indole-4-carboxamide.
| Compound Name | 7-morpholin-4-ylsulfonyl-2-phenyl-5H-pyrido[3,2-b]indole-4-carboxamide |
|---|---|
| PubChem CID | 66604540 |
| Molecular Formula | C22H20N4O4S |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | 7-morpholin-4-ylsulfonyl-2-phenyl-5H-pyrido[3,2-b]indole-4-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)nc2c1[nH]c1cc(S(=O)(=O)N3CCOCC3)ccc12 |
| InChI | InChI=1S/C22H20N4O4S/c23-22(27)17-13-18(14-4-2-1-3-5-14)24-20-16-7-6-15(12-19(16)25-21(17)20)31(28,29)26-8-10-30-11-9-26/h1-7,12-13,25H,8-11H2,(H2,23,27) |
| InChIKey | FYGPNOQCQCKANY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |