C9H13NO6S — CID 66605276
hydrogen sulfate;1-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]ethanone (PubChem CID 66605276) has the molecular formula C9H13NO6S and a molecular weight of 263.27 g/mol. Its IUPAC name is hydrogen sulfate;1-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]ethanone.
| Compound Name | hydrogen sulfate;1-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]ethanone |
|---|---|
| PubChem CID | 66605276 |
| Molecular Formula | C9H13NO6S |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | hydrogen sulfate;1-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]ethanone |
| SMILES | CC(=O)c1cc[n+](CCO)cc1.O=S(=O)([O-])O |
| InChI | InChI=1S/C9H12NO2.H2O4S/c1-8(12)9-2-4-10(5-3-9)6-7-11;1-5(2,3)4/h2-5,11H,6-7H2,1H3;(H2,1,2,3,4)/q+1;/p-1 |
| InChIKey | ZRDCCJOOUXXUMB-UHFFFAOYSA-M |
| XLogP | -0.83 |
| TPSA | 118.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|