C16H18NO4S+ — CID 87149815
2-(4-acetylpyridin-1-ium-1-yl)ethyl 4-methylbenzenesulfonate (PubChem CID 87149815) has the molecular formula C16H18NO4S+ and a molecular weight of 320.39 g/mol. Its IUPAC name is 2-(4-acetylpyridin-1-ium-1-yl)ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-(4-acetylpyridin-1-ium-1-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87149815 |
| Molecular Formula | C16H18NO4S+ |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-(4-acetylpyridin-1-ium-1-yl)ethyl 4-methylbenzenesulfonate |
| SMILES | CC(=O)c1cc[n+](CCOS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C16H18NO4S/c1-13-3-5-16(6-4-13)22(19,20)21-12-11-17-9-7-15(8-10-17)14(2)18/h3-10H,11-12H2,1-2H3/q+1 |
| InChIKey | MALCFDYPFDLDBB-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|