C16H17NO5S — CID 3129673
2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]-3-(4-hydroxyphenyl)prop-2-ene-1-sulfonate (PubChem CID 3129673) has the molecular formula C16H17NO5S and a molecular weight of 335.38 g/mol. Its IUPAC name is 2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]-3-(4-hydroxyphenyl)prop-2-ene-1-sulfonate.
| Compound Name | 2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]-3-(4-hydroxyphenyl)prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 3129673 |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.38 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[1-(2-hydroxyethyl)pyridin-1-ium-4-yl]-3-(4-hydroxyphenyl)prop-2-ene-1-sulfonate |
| SMILES | O=S(=O)([O-])CC(=Cc1ccc(O)cc1)c1cc[n+](CCO)cc1 |
| InChI | InChI=1S/C16H17NO5S/c18-10-9-17-7-5-14(6-8-17)15(12-23(20,21)22)11-13-1-3-16(19)4-2-13/h1-8,11,18H,9-10,12H2,(H,20,21,22) |
| InChIKey | QQEQAOXNBRATNE-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 101.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.38 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|