About 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate
1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate (PubChem CID 87281395) has the molecular formula C17H19NO6S
and a molecular weight of 365.41 g/mol. Its IUPAC name is 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate.
Molecular Properties
| Compound Name | 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate |
| PubChem CID | 87281395 |
| Molecular Formula | C17H19NO6S |
| Molecular Weight | 365.41 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate |
| SMILES | CC(=O)c1cccc(C(C)=O)[n+]1CCO.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C11H14NO3.C6H6O3S/c1-8(14)10-4-3-5-11(9(2)15)12(10)6-7-13;7-10(8,9)6-4-2-1-3-5-6/h3-5,13H,6-7H2,1-2H3;1-5H,(H,7,8,9)/q+1;/p-1 |
| InChIKey | PLQCFJDLYYPSEL-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.41 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate?
The IUPAC name of 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate (CID 87281395) is 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate.
What is the SMILES notation for 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate?
The canonical SMILES for 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate is CC(=O)c1cccc(C(C)=O)[n+]1CCO.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate?
The InChIKey is PLQCFJDLYYPSEL-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14NO3.C6H6O3S/c1-8(14)10-4-3-5-11(9(2)15)12(10)6-7-13;7-10(8,9)6-4-2-1-3-5-6/h3-5,13H,6-7H2,1-2H3;1-5H,(H,7,8,9)/q+1;/p-1.
What are the key properties of 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate?
1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate has a molecular weight of 365.41 g/mol, XLogP of 0.96, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;benzenesulfonate is sourced from PubChem (CID 87281395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).