C18H21NO6S — CID 87281368
1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;4-methylbenzenesulfonate (PubChem CID 87281368) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;4-methylbenzenesulfonate.
| Compound Name | 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87281368 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | 1-[6-acetyl-1-(2-hydroxyethyl)pyridin-1-ium-2-yl]ethanone;4-methylbenzenesulfonate |
| SMILES | CC(=O)c1cccc(C(C)=O)[n+]1CCO.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H14NO3.C7H8O3S/c1-8(14)10-4-3-5-11(9(2)15)12(10)6-7-13;1-6-2-4-7(5-3-6)11(8,9)10/h3-5,13H,6-7H2,1-2H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | NJVFKZZKARAIRQ-UHFFFAOYSA-M |
| XLogP | 1.27 |
| TPSA | 115.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|