About benzenesulfonate;2-hydroxyethyl(dimethyl)azanium
benzenesulfonate;2-hydroxyethyl(dimethyl)azanium (PubChem CID 139841856) has the molecular formula C10H17NO4S
and a molecular weight of 247.32 g/mol. Its IUPAC name is benzenesulfonate;2-hydroxyethyl(dimethyl)azanium.
Molecular Properties
| Compound Name | benzenesulfonate;2-hydroxyethyl(dimethyl)azanium |
| PubChem CID | 139841856 |
| Molecular Formula | C10H17NO4S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | benzenesulfonate;2-hydroxyethyl(dimethyl)azanium |
| SMILES | C[NH+](C)CCO.O=S(=O)([O-])c1ccccc1 |
| InChI | InChI=1S/C6H6O3S.C4H11NO/c7-10(8,9)6-4-2-1-3-5-6;1-5(2)3-4-6/h1-5H,(H,7,8,9);6H,3-4H2,1-2H3 |
| InChIKey | VNXFIDYJVWELSR-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 81.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze benzenesulfonate;2-hydroxyethyl(dimethyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenesulfonate;2-hydroxyethyl(dimethyl)azanium?
The IUPAC name of benzenesulfonate;2-hydroxyethyl(dimethyl)azanium (CID 139841856) is benzenesulfonate;2-hydroxyethyl(dimethyl)azanium.
What is the SMILES notation for benzenesulfonate;2-hydroxyethyl(dimethyl)azanium?
The canonical SMILES for benzenesulfonate;2-hydroxyethyl(dimethyl)azanium is C[NH+](C)CCO.O=S(=O)([O-])c1ccccc1.
What is the InChIKey of benzenesulfonate;2-hydroxyethyl(dimethyl)azanium?
The InChIKey is VNXFIDYJVWELSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O3S.C4H11NO/c7-10(8,9)6-4-2-1-3-5-6;1-5(2)3-4-6/h1-5H,(H,7,8,9);6H,3-4H2,1-2H3.
What are the key properties of benzenesulfonate;2-hydroxyethyl(dimethyl)azanium?
benzenesulfonate;2-hydroxyethyl(dimethyl)azanium has a molecular weight of 247.32 g/mol, XLogP of -1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzenesulfonate;2-hydroxyethyl(dimethyl)azanium is sourced from PubChem (CID 139841856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).