C8H16N2O2 — CID 66610084
2-(1,3-dioxolan-2-ylmethyl)piperazine (PubChem CID 66610084) has the molecular formula C8H16N2O2 and a molecular weight of 172.23 g/mol. Its IUPAC name is 2-(1,3-dioxolan-2-ylmethyl)piperazine.
| Compound Name | 2-(1,3-dioxolan-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 66610084 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 2-(1,3-dioxolan-2-ylmethyl)piperazine |
| SMILES | C1CNC(CC2OCCO2)CN1 |
| InChI | InChI=1S/C8H16N2O2/c1-2-10-7(6-9-1)5-8-11-3-4-12-8/h7-10H,1-6H2 |
| InChIKey | XRENNVNLMMXBKI-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |