C28H25BrFNO5 — CID 6661834
(3aS,6R,11aS,11bR)-9-bromo-2-cyclohexyl-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6661834) has the molecular formula C28H25BrFNO5 and a molecular weight of 554.41 g/mol. Its IUPAC name is (3aS,6R,11aS,11bR)-9-bromo-2-cyclohexyl-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,11aS,11bR)-9-bromo-2-cyclohexyl-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6661834 |
| Molecular Formula | C28H25BrFNO5 |
| Molecular Weight | 554.41 g/mol |
| Exact Mass | 553.09 |
| IUPAC Name | (3aS,6R,11aS,11bR)-9-bromo-2-cyclohexyl-6-(3-fluoro-2-hydroxyphenyl)-3a,4,6,11,11a,11b-hexahydronaphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | O=C1C=C(Br)C(=O)C2=C1[C@@H](c1cccc(F)c1O)C1=CC[C@@H]3C(=O)N(C4CCCCC4)C(=O)[C@@H]3[C@@H]1C2 |
| InChI | InChI=1S/C28H25BrFNO5/c29-19-12-21(32)24-18(25(19)33)11-17-14(22(24)15-7-4-8-20(30)26(15)34)9-10-16-23(17)28(36)31(27(16)35)13-5-2-1-3-6-13/h4,7-9,12-13,16-17,22-23,34H,1-3,5-6,10-11H2/t16-,17+,22+,23-/m0/s1 |
| InChIKey | OXJXVEMZWAEJFY-QOKUDNMUSA-N |
| XLogP | 4.63 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.41 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|