C28H38BrN5O4Si — CID 66620353
tert-butyl 2-[4-(4-bromophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyrazin-2-yloxypyrrolidine-1-carboxylate (PubChem CID 66620353) has the molecular formula C28H38BrN5O4Si and a molecular weight of 616.63 g/mol. Its IUPAC name is tert-butyl 2-[4-(4-bromophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyrazin-2-yloxypyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[4-(4-bromophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyrazin-2-yloxypyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 66620353 |
| Molecular Formula | C28H38BrN5O4Si |
| Molecular Weight | 616.63 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | tert-butyl 2-[4-(4-bromophenyl)-1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]-4-pyrazin-2-yloxypyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(Oc2cnccn2)CC1c1nc(-c2ccc(Br)cc2)cn1COCC[Si](C)(C)C |
| InChI | InChI=1S/C28H38BrN5O4Si/c1-28(2,3)38-27(35)34-17-22(37-25-16-30-11-12-31-25)15-24(34)26-32-23(20-7-9-21(29)10-8-20)18-33(26)19-36-13-14-39(4,5)6/h7-12,16,18,22,24H,13-15,17,19H2,1-6H3 |
| InChIKey | DMRVIGBDZQUFGQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 91.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.63 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|