C27H43BrN3O5Si+ — CID 123711213
tert-butyl (2S,4S)-2-[5-(4-bromophenyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-4-(2-methoxyethoxy)pyrrolidine-1-carboxylate (PubChem CID 123711213) has the molecular formula C27H43BrN3O5Si+ and a molecular weight of 597.65 g/mol. Its IUPAC name is tert-butyl (2S,4S)-2-[5-(4-bromophenyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-4-(2-methoxyethoxy)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4S)-2-[5-(4-bromophenyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-4-(2-methoxyethoxy)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 123711213 |
| Molecular Formula | C27H43BrN3O5Si+ |
| Molecular Weight | 597.65 g/mol |
| Exact Mass | 596.21 |
| IUPAC Name | tert-butyl (2S,4S)-2-[5-(4-bromophenyl)-3-(2-trimethylsilylethoxymethyl)-1H-imidazol-3-ium-2-yl]-4-(2-methoxyethoxy)pyrrolidine-1-carboxylate |
| SMILES | COCCO[C@H]1C[C@@H](c2[nH]c(-c3ccc(Br)cc3)c[n+]2COCC[Si](C)(C)C)N(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C27H42BrN3O5Si/c1-27(2,3)36-26(32)31-17-22(35-13-12-33-4)16-24(31)25-29-23(20-8-10-21(28)11-9-20)18-30(25)19-34-14-15-37(5,6)7/h8-11,18,22,24H,12-17,19H2,1-7H3/p+1/t22-,24-/m0/s1 |
| InChIKey | KKSNSBZNUVDVEB-UPVQGACJSA-O |
| XLogP | 5.76 |
| TPSA | 76.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.65 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|