C31H39FN2O4 — CID 66625859
(6R)-6-[2-[3-[4-(2-amino-2-methylpropoxy)-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66625859) has the molecular formula C31H39FN2O4 and a molecular weight of 522.66 g/mol. Its IUPAC name is (6R)-6-[2-[3-[4-(2-amino-2-methylpropoxy)-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6R)-6-[2-[3-[4-(2-amino-2-methylpropoxy)-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66625859 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (6R)-6-[2-[3-[4-(2-amino-2-methylpropoxy)-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(NCCCc2ccc(OCC(C)(C)N)c(F)c2)c([C@@H]2CCc3cc(O)ccc3C2)cc1OC |
| InChI | InChI=1S/C31H39FN2O4/c1-31(2,33)19-38-28-12-7-20(14-26(28)32)6-5-13-34-27-18-30(37-4)29(36-3)17-25(27)23-9-8-22-16-24(35)11-10-21(22)15-23/h7,10-12,14,16-18,23,34-35H,5-6,8-9,13,15,19,33H2,1-4H3/t23-/m1/s1 |
| InChIKey | XWNBHAJEHIVXHU-HSZRJFAPSA-N |
| XLogP | 5.98 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|