C34H38N2O5 — CID 42599213
2-[6,7-dimethoxy-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methoxy-N-(2-phenoxyethyl)aniline (PubChem CID 42599213) has the molecular formula C34H38N2O5 and a molecular weight of 554.69 g/mol. Its IUPAC name is 2-[6,7-dimethoxy-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methoxy-N-(2-phenoxyethyl)aniline.
| Compound Name | 2-[6,7-dimethoxy-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methoxy-N-(2-phenoxyethyl)aniline |
|---|---|
| PubChem CID | 42599213 |
| Molecular Formula | C34H38N2O5 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.28 |
| IUPAC Name | 2-[6,7-dimethoxy-2-(2-phenoxyethyl)-3,4-dihydro-1H-isoquinolin-1-yl]-4-methoxy-N-(2-phenoxyethyl)aniline |
| SMILES | COc1ccc(NCCOc2ccccc2)c(C2c3cc(OC)c(OC)cc3CCN2CCOc2ccccc2)c1 |
| InChI | InChI=1S/C34H38N2O5/c1-37-28-14-15-31(35-17-20-40-26-10-6-4-7-11-26)30(23-28)34-29-24-33(39-3)32(38-2)22-25(29)16-18-36(34)19-21-41-27-12-8-5-9-13-27/h4-15,22-24,34-35H,16-21H2,1-3H3 |
| InChIKey | PVEJWMIAHOEFJF-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 61.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|