C30H38N2O2 — CID 66626739
6-[2-[3-[4-[2-(dimethylamino)ethyl]phenyl]propylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66626739) has the molecular formula C30H38N2O2 and a molecular weight of 458.65 g/mol. Its IUPAC name is 6-[2-[3-[4-[2-(dimethylamino)ethyl]phenyl]propylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[2-[3-[4-[2-(dimethylamino)ethyl]phenyl]propylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66626739 |
| Molecular Formula | C30H38N2O2 |
| Molecular Weight | 458.65 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | 6-[2-[3-[4-[2-(dimethylamino)ethyl]phenyl]propylamino]-4-methoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1ccc(C2CCc3cc(O)ccc3C2)c(NCCCc2ccc(CCN(C)C)cc2)c1 |
| InChI | InChI=1S/C30H38N2O2/c1-32(2)18-16-23-8-6-22(7-9-23)5-4-17-31-30-21-28(34-3)14-15-29(30)26-11-10-25-20-27(33)13-12-24(25)19-26/h6-9,12-15,20-21,26,31,33H,4-5,10-11,16-19H2,1-3H3 |
| InChIKey | IOMMZGNBUBBBHM-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.65 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|