C31H39FN2O4 — CID 66626894
(6R)-6-[2-[3-[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66626894) has the molecular formula C31H39FN2O4 and a molecular weight of 522.66 g/mol. Its IUPAC name is (6R)-6-[2-[3-[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6R)-6-[2-[3-[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66626894 |
| Molecular Formula | C31H39FN2O4 |
| Molecular Weight | 522.66 g/mol |
| Exact Mass | 522.29 |
| IUPAC Name | (6R)-6-[2-[3-[4-[2-(dimethylamino)ethoxy]-3-fluorophenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(NCCCc2ccc(OCCN(C)C)c(F)c2)c([C@@H]2CCc3cc(O)ccc3C2)cc1OC |
| InChI | InChI=1S/C31H39FN2O4/c1-34(2)14-15-38-29-12-7-21(16-27(29)32)6-5-13-33-28-20-31(37-4)30(36-3)19-26(28)24-9-8-23-18-25(35)11-10-22(23)17-24/h7,10-12,16,18-20,24,33,35H,5-6,8-9,13-15,17H2,1-4H3/t24-/m1/s1 |
| InChIKey | LQVZZALEHMZNGN-XMMPIXPASA-N |
| XLogP | 5.81 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.66 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|