C34H46N2O4 — CID 66627424
6-[2-[1-[4-[2-(2,2-dimethylpropylamino)ethoxy]phenyl]propan-2-ylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66627424) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 6-[2-[1-[4-[2-(2,2-dimethylpropylamino)ethoxy]phenyl]propan-2-ylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[2-[1-[4-[2-(2,2-dimethylpropylamino)ethoxy]phenyl]propan-2-ylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66627424 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 6-[2-[1-[4-[2-(2,2-dimethylpropylamino)ethoxy]phenyl]propan-2-ylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(NC(C)Cc2ccc(OCCNCC(C)(C)C)cc2)c(C2CCc3cc(O)ccc3C2)cc1OC |
| InChI | InChI=1S/C34H46N2O4/c1-23(17-24-7-13-29(14-8-24)40-16-15-35-22-34(2,3)4)36-31-21-33(39-6)32(38-5)20-30(31)27-10-9-26-19-28(37)12-11-25(26)18-27/h7-8,11-14,19-21,23,27,35-37H,9-10,15-18,22H2,1-6H3 |
| InChIKey | GBOXLWVJOCMMIS-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|