C34H46N2O4 — CID 66627336
6-[4,5-dimethoxy-2-[1-[4-[2-(pentylamino)ethoxy]phenyl]propan-2-ylamino]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66627336) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 6-[4,5-dimethoxy-2-[1-[4-[2-(pentylamino)ethoxy]phenyl]propan-2-ylamino]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[4,5-dimethoxy-2-[1-[4-[2-(pentylamino)ethoxy]phenyl]propan-2-ylamino]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66627336 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 6-[4,5-dimethoxy-2-[1-[4-[2-(pentylamino)ethoxy]phenyl]propan-2-ylamino]phenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | CCCCCNCCOc1ccc(CC(C)Nc2cc(OC)c(OC)cc2C2CCc3cc(O)ccc3C2)cc1 |
| InChI | InChI=1S/C34H46N2O4/c1-5-6-7-16-35-17-18-40-30-14-8-25(9-15-30)19-24(2)36-32-23-34(39-4)33(38-3)22-31(32)28-11-10-27-21-29(37)13-12-26(27)20-28/h8-9,12-15,21-24,28,35-37H,5-7,10-11,16-20H2,1-4H3 |
| InChIKey | VESKWVUWTLBVRN-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 71.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|