C33H44N2O4 — CID 66626294
(6R)-6-[2-[3-[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66626294) has the molecular formula C33H44N2O4 and a molecular weight of 532.73 g/mol. Its IUPAC name is (6R)-6-[2-[3-[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | (6R)-6-[2-[3-[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66626294 |
| Molecular Formula | C33H44N2O4 |
| Molecular Weight | 532.73 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | (6R)-6-[2-[3-[4-[2-(dimethylamino)-2-methylpropoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(NCCCc2ccc(OCC(C)(C)N(C)C)cc2)c([C@@H]2CCc3cc(O)ccc3C2)cc1OC |
| InChI | InChI=1S/C33H44N2O4/c1-33(2,35(3)4)22-39-28-15-9-23(10-16-28)8-7-17-34-30-21-32(38-6)31(37-5)20-29(30)26-12-11-25-19-27(36)14-13-24(25)18-26/h9-10,13-16,19-21,26,34,36H,7-8,11-12,17-18,22H2,1-6H3/t26-/m1/s1 |
| InChIKey | MYJRMRHAKKNIQR-AREMUKBSSA-N |
| XLogP | 6.45 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.73 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|