C34H46N2O4 — CID 66627425
6-[2-[3-[4-[2-[tert-butyl(methyl)amino]ethoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol (PubChem CID 66627425) has the molecular formula C34H46N2O4 and a molecular weight of 546.75 g/mol. Its IUPAC name is 6-[2-[3-[4-[2-[tert-butyl(methyl)amino]ethoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol.
| Compound Name | 6-[2-[3-[4-[2-[tert-butyl(methyl)amino]ethoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 66627425 |
| Molecular Formula | C34H46N2O4 |
| Molecular Weight | 546.75 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 6-[2-[3-[4-[2-[tert-butyl(methyl)amino]ethoxy]phenyl]propylamino]-4,5-dimethoxyphenyl]-5,6,7,8-tetrahydronaphthalen-2-ol |
| SMILES | COc1cc(NCCCc2ccc(OCCN(C)C(C)(C)C)cc2)c(C2CCc3cc(O)ccc3C2)cc1OC |
| InChI | InChI=1S/C34H46N2O4/c1-34(2,3)36(4)18-19-40-29-15-9-24(10-16-29)8-7-17-35-31-23-33(39-6)32(38-5)22-30(31)27-12-11-26-21-28(37)14-13-25(26)20-27/h9-10,13-16,21-23,27,35,37H,7-8,11-12,17-20H2,1-6H3 |
| InChIKey | CPXCYBJNXXFLGZ-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 63.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.75 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|