C22H30Cl2N2O2 — CID 66627833
2-[4-[2-[4-(2,5-dichlorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]acetamide (PubChem CID 66627833) has the molecular formula C22H30Cl2N2O2 and a molecular weight of 425.40 g/mol. Its IUPAC name is 2-[4-[2-[4-(2,5-dichlorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]acetamide.
| Compound Name | 2-[4-[2-[4-(2,5-dichlorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 66627833 |
| Molecular Formula | C22H30Cl2N2O2 |
| Molecular Weight | 425.40 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2-[4-[2-[4-(2,5-dichlorobenzoyl)piperidin-1-yl]ethyl]cyclohexyl]acetamide |
| SMILES | NC(=O)CC1CCC(CCN2CCC(C(=O)c3cc(Cl)ccc3Cl)CC2)CC1 |
| InChI | InChI=1S/C22H30Cl2N2O2/c23-18-5-6-20(24)19(14-18)22(28)17-8-11-26(12-9-17)10-7-15-1-3-16(4-2-15)13-21(25)27/h5-6,14-17H,1-4,7-13H2,(H2,25,27) |
| InChIKey | BGSFDBIFQVYZHG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.40 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |