C21H25N3O2 — CID 66635532
3-[1-[4-[2-(2-ethoxy-4-pyridinyl)ethynyl]phenyl]propan-2-yl]-1,1-dimethylurea (PubChem CID 66635532) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 3-[1-[4-[2-(2-ethoxy-4-pyridinyl)ethynyl]phenyl]propan-2-yl]-1,1-dimethylurea.
| Compound Name | 3-[1-[4-[2-(2-ethoxy-4-pyridinyl)ethynyl]phenyl]propan-2-yl]-1,1-dimethylurea |
|---|---|
| PubChem CID | 66635532 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 3-[1-[4-[2-(2-ethoxy-4-pyridinyl)ethynyl]phenyl]propan-2-yl]-1,1-dimethylurea |
| SMILES | CCOc1cc(C#Cc2ccc(CC(C)NC(=O)N(C)C)cc2)ccn1 |
| InChI | InChI=1S/C21H25N3O2/c1-5-26-20-15-19(12-13-22-20)11-8-17-6-9-18(10-7-17)14-16(2)23-21(25)24(3)4/h6-7,9-10,12-13,15-16H,5,14H2,1-4H3,(H,23,25) |
| InChIKey | WASSEMBNQXZEHM-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|