C20H23FN4O — CID 66636765
7-(cyclohexylamino)-6-fluoro-4-oxo-1-pyrrolidin-3-ylquinoline-3-carbonitrile (PubChem CID 66636765) has the molecular formula C20H23FN4O and a molecular weight of 354.43 g/mol. Its IUPAC name is 7-(cyclohexylamino)-6-fluoro-4-oxo-1-pyrrolidin-3-ylquinoline-3-carbonitrile.
| Compound Name | 7-(cyclohexylamino)-6-fluoro-4-oxo-1-pyrrolidin-3-ylquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 66636765 |
| Molecular Formula | C20H23FN4O |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | 7-(cyclohexylamino)-6-fluoro-4-oxo-1-pyrrolidin-3-ylquinoline-3-carbonitrile |
| SMILES | N#Cc1cn(C2CCNC2)c2cc(NC3CCCCC3)c(F)cc2c1=O |
| InChI | InChI=1S/C20H23FN4O/c21-17-8-16-19(9-18(17)24-14-4-2-1-3-5-14)25(15-6-7-23-11-15)12-13(10-22)20(16)26/h8-9,12,14-15,23-24H,1-7,11H2 |
| InChIKey | IEJVJYVGKYWSLE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |