C17H18F3N3O4S — CID 66639656
ethyl 3-[ethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]pyrazine-2-carboxylate (PubChem CID 66639656) has the molecular formula C17H18F3N3O4S and a molecular weight of 417.41 g/mol. Its IUPAC name is ethyl 3-[ethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]pyrazine-2-carboxylate.
| Compound Name | ethyl 3-[ethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 66639656 |
| Molecular Formula | C17H18F3N3O4S |
| Molecular Weight | 417.41 g/mol |
| Exact Mass | 417.10 |
| IUPAC Name | ethyl 3-[ethyl-[[3-(trifluoromethyl)phenyl]methylsulfonyl]amino]pyrazine-2-carboxylate |
| SMILES | CCOC(=O)c1nccnc1N(CC)S(=O)(=O)Cc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3O4S/c1-3-23(15-14(16(24)27-4-2)21-8-9-22-15)28(25,26)11-12-6-5-7-13(10-12)17(18,19)20/h5-10H,3-4,11H2,1-2H3 |
| InChIKey | ZHUFJRVLJVCHLY-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 89.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.41 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |