C16H15F3O4S — CID 52883540
(4-ethoxyphenyl) [3-(trifluoromethyl)phenyl]methanesulfonate (PubChem CID 52883540) has the molecular formula C16H15F3O4S and a molecular weight of 360.35 g/mol. Its IUPAC name is (4-ethoxyphenyl) [3-(trifluoromethyl)phenyl]methanesulfonate.
| Compound Name | (4-ethoxyphenyl) [3-(trifluoromethyl)phenyl]methanesulfonate |
|---|---|
| PubChem CID | 52883540 |
| Molecular Formula | C16H15F3O4S |
| Molecular Weight | 360.35 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | (4-ethoxyphenyl) [3-(trifluoromethyl)phenyl]methanesulfonate |
| SMILES | CCOc1ccc(OS(=O)(=O)Cc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H15F3O4S/c1-2-22-14-6-8-15(9-7-14)23-24(20,21)11-12-4-3-5-13(10-12)16(17,18)19/h3-10H,2,11H2,1H3 |
| InChIKey | VLPRBHSKMQHHPZ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.35 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|