C17H18N4O4S — CID 66648556
7,7-dimethyl-2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-6,8-dihydro-5H-[1,3]thiazolo[5,4-c]azepin-4-one (PubChem CID 66648556) has the molecular formula C17H18N4O4S and a molecular weight of 374.42 g/mol. Its IUPAC name is 7,7-dimethyl-2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-6,8-dihydro-5H-[1,3]thiazolo[5,4-c]azepin-4-one.
| Compound Name | 7,7-dimethyl-2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-6,8-dihydro-5H-[1,3]thiazolo[5,4-c]azepin-4-one |
|---|---|
| PubChem CID | 66648556 |
| Molecular Formula | C17H18N4O4S |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 7,7-dimethyl-2-(7-nitro-2,3-dihydro-1,4-benzoxazin-4-yl)-6,8-dihydro-5H-[1,3]thiazolo[5,4-c]azepin-4-one |
| SMILES | CC1(C)CNC(=O)c2sc(N3CCOc4cc([N+](=O)[O-])ccc43)nc2C1 |
| InChI | InChI=1S/C17H18N4O4S/c1-17(2)8-11-14(15(22)18-9-17)26-16(19-11)20-5-6-25-13-7-10(21(23)24)3-4-12(13)20/h3-4,7H,5-6,8-9H2,1-2H3,(H,18,22) |
| InChIKey | ZNZSMHFMGKZITD-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|