C22H29N5O2S — CID 67186645
6,6-dimethyl-2-[7-[methyl-(1-methylpyrrolidin-3-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one (PubChem CID 67186645) has the molecular formula C22H29N5O2S and a molecular weight of 427.57 g/mol. Its IUPAC name is 6,6-dimethyl-2-[7-[methyl-(1-methylpyrrolidin-3-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one.
| Compound Name | 6,6-dimethyl-2-[7-[methyl-(1-methylpyrrolidin-3-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
|---|---|
| PubChem CID | 67186645 |
| Molecular Formula | C22H29N5O2S |
| Molecular Weight | 427.57 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 6,6-dimethyl-2-[7-[methyl-(1-methylpyrrolidin-3-yl)amino]-2,3-dihydro-1,4-benzoxazin-4-yl]-5,7-dihydro-[1,3]thiazolo[5,4-c]pyridin-4-one |
| SMILES | CN1CCC(N(C)c2ccc3c(c2)OCCN3c2nc3c(s2)C(=O)NC(C)(C)C3)C1 |
| InChI | InChI=1S/C22H29N5O2S/c1-22(2)12-16-19(20(28)24-22)30-21(23-16)27-9-10-29-18-11-14(5-6-17(18)27)26(4)15-7-8-25(3)13-15/h5-6,11,15H,7-10,12-13H2,1-4H3,(H,24,28) |
| InChIKey | ZTIYCDAGDFAAGJ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.57 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |