C6H9O6P — CID 66648582
(2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl) 2-methylprop-2-enoate (PubChem CID 66648582) has the molecular formula C6H9O6P and a molecular weight of 208.11 g/mol. Its IUPAC name is (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl) 2-methylprop-2-enoate.
| Compound Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66648582 |
| Molecular Formula | C6H9O6P |
| Molecular Weight | 208.11 g/mol |
| Exact Mass | 208.01 |
| IUPAC Name | (2-hydroxy-2-oxo-1,3,2λ5-dioxaphospholan-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1COP(=O)(O)O1 |
| InChI | InChI=1S/C6H9O6P/c1-4(2)6(7)11-5-3-10-13(8,9)12-5/h5H,1,3H2,2H3,(H,8,9) |
| InChIKey | XPTAYXCXYFWRIF-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.11 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|