C22H18Cl2F3N3O4S — CID 66648866
5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]-N-methyl-N-phenylpyridine-2-carboxamide (PubChem CID 66648866) has the molecular formula C22H18Cl2F3N3O4S and a molecular weight of 548.37 g/mol. Its IUPAC name is 5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]-N-methyl-N-phenylpyridine-2-carboxamide.
| Compound Name | 5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]-N-methyl-N-phenylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 66648866 |
| Molecular Formula | C22H18Cl2F3N3O4S |
| Molecular Weight | 548.37 g/mol |
| Exact Mass | 547.03 |
| IUPAC Name | 5-chloro-3-[[4-chloro-3-(trifluoromethyl)phenyl]sulfonylmethoxymethylamino]-N-methyl-N-phenylpyridine-2-carboxamide |
| SMILES | CN(C(=O)c1ncc(Cl)cc1NCOCS(=O)(=O)c1ccc(Cl)c(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C22H18Cl2F3N3O4S/c1-30(15-5-3-2-4-6-15)21(31)20-19(9-14(23)11-28-20)29-12-34-13-35(32,33)16-7-8-18(24)17(10-16)22(25,26)27/h2-11,29H,12-13H2,1H3 |
| InChIKey | PQMXMWASJIFDJX-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.37 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|