C15H11N3O3 — CID 66653420
2-amino-5-(imidazo[1,5-a]pyridine-3-carbonyl)benzoic acid (PubChem CID 66653420) has the molecular formula C15H11N3O3 and a molecular weight of 281.27 g/mol. Its IUPAC name is 2-amino-5-(imidazo[1,5-a]pyridine-3-carbonyl)benzoic acid.
| Compound Name | 2-amino-5-(imidazo[1,5-a]pyridine-3-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 66653420 |
| Molecular Formula | C15H11N3O3 |
| Molecular Weight | 281.27 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 2-amino-5-(imidazo[1,5-a]pyridine-3-carbonyl)benzoic acid |
| SMILES | Nc1ccc(C(=O)c2ncc3ccccn23)cc1C(=O)O |
| InChI | InChI=1S/C15H11N3O3/c16-12-5-4-9(7-11(12)15(20)21)13(19)14-17-8-10-3-1-2-6-18(10)14/h1-8H,16H2,(H,20,21) |
| InChIKey | YRZHKXSZQZYZRN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|