About 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine
1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine (PubChem CID 66656029) has the molecular formula C13H7F3IN3
and a molecular weight of 389.12 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine.
Molecular Properties
| Compound Name | 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine |
| PubChem CID | 66656029 |
| Molecular Formula | C13H7F3IN3 |
| Molecular Weight | 389.12 g/mol |
| Exact Mass | 388.96 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine |
| SMILES | Fc1ccc(Cn2nc(I)c3cc(F)cnc32)c(F)c1 |
| InChI | InChI=1S/C13H7F3IN3/c14-8-2-1-7(11(16)4-8)6-20-13-10(12(17)19-20)3-9(15)5-18-13/h1-5H,6H2 |
| InChIKey | SAYGWPKOAMPMKI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.12 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine?
The IUPAC name of 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine (CID 66656029) is 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine.
What is the SMILES notation for 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine?
The canonical SMILES for 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine is Fc1ccc(Cn2nc(I)c3cc(F)cnc32)c(F)c1.
What is the InChIKey of 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine?
The InChIKey is SAYGWPKOAMPMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H7F3IN3/c14-8-2-1-7(11(16)4-8)6-20-13-10(12(17)19-20)3-9(15)5-18-13/h1-5H,6H2.
What are the key properties of 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine?
1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine has a molecular weight of 389.12 g/mol, XLogP of 3.50, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)methyl]-5-fluoro-3-iodopyrazolo[5,4-b]pyridine is sourced from PubChem (CID 66656029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).