C28H31N3O5 — CID 66658222
[4-[(3-benzamido-2-hydroxy-3-phenylpropanoyl)amino]phenyl]methyl-tert-butylcarbamic acid (PubChem CID 66658222) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is [4-[(3-benzamido-2-hydroxy-3-phenylpropanoyl)amino]phenyl]methyl-tert-butylcarbamic acid.
| Compound Name | [4-[(3-benzamido-2-hydroxy-3-phenylpropanoyl)amino]phenyl]methyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66658222 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [4-[(3-benzamido-2-hydroxy-3-phenylpropanoyl)amino]phenyl]methyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(Cc1ccc(NC(=O)C(O)C(NC(=O)c2ccccc2)c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C28H31N3O5/c1-28(2,3)31(27(35)36)18-19-14-16-22(17-15-19)29-26(34)24(32)23(20-10-6-4-7-11-20)30-25(33)21-12-8-5-9-13-21/h4-17,23-24,32H,18H2,1-3H3,(H,29,34)(H,30,33)(H,35,36) |
| InChIKey | LSUOASINRXUYNA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |