C23H18FNO3 — CID 66659267
2-(3-fluorophenyl)-6-methoxy-7-phenylmethoxy-3H-quinolin-4-one (PubChem CID 66659267) has the molecular formula C23H18FNO3 and a molecular weight of 375.40 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-6-methoxy-7-phenylmethoxy-3H-quinolin-4-one.
| Compound Name | 2-(3-fluorophenyl)-6-methoxy-7-phenylmethoxy-3H-quinolin-4-one |
|---|---|
| PubChem CID | 66659267 |
| Molecular Formula | C23H18FNO3 |
| Molecular Weight | 375.40 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 2-(3-fluorophenyl)-6-methoxy-7-phenylmethoxy-3H-quinolin-4-one |
| SMILES | COc1cc2c(cc1OCc1ccccc1)N=C(c1cccc(F)c1)CC2=O |
| InChI | InChI=1S/C23H18FNO3/c1-27-22-11-18-20(13-23(22)28-14-15-6-3-2-4-7-15)25-19(12-21(18)26)16-8-5-9-17(24)10-16/h2-11,13H,12,14H2,1H3 |
| InChIKey | KLCLLEJBPGRPDZ-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.40 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |