C18H20FNO4 — CID 66665415
methyl 7-[(4-fluorophenyl)methylamino]-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate (PubChem CID 66665415) has the molecular formula C18H20FNO4 and a molecular weight of 333.36 g/mol. Its IUPAC name is methyl 7-[(4-fluorophenyl)methylamino]-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate.
| Compound Name | methyl 7-[(4-fluorophenyl)methylamino]-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate |
|---|---|
| PubChem CID | 66665415 |
| Molecular Formula | C18H20FNO4 |
| Molecular Weight | 333.36 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | methyl 7-[(4-fluorophenyl)methylamino]-2,3-dioxobicyclo[3.2.2]nonane-6-carboxylate |
| SMILES | COC(=O)C1C2CCC(C(=O)C(=O)C2)C1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO4/c1-24-18(23)15-11-4-7-13(17(22)14(21)8-11)16(15)20-9-10-2-5-12(19)6-3-10/h2-3,5-6,11,13,15-16,20H,4,7-9H2,1H3 |
| InChIKey | PVNCBWPPSBOYER-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|