C31H35NO8 — CID 6666591
6-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-6-methoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]hexanoic acid (PubChem CID 6666591) has the molecular formula C31H35NO8 and a molecular weight of 549.62 g/mol. Its IUPAC name is 6-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-6-methoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]hexanoic acid.
| Compound Name | 6-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-6-methoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 6666591 |
| Molecular Formula | C31H35NO8 |
| Molecular Weight | 549.62 g/mol |
| Exact Mass | 549.24 |
| IUPAC Name | 6-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(2-hydroxy-6-methoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]hexanoic acid |
| SMILES | COc1cccc(O)c1[C@H]1C2=CC[C@@H]3C(=O)N(CCCCCC(=O)O)C(=O)[C@@H]3[C@@H]2C[C@H]2C(=O)C=C(C)C(=O)[C@@]12C |
| InChI | InChI=1S/C31H35NO8/c1-16-14-22(34)20-15-19-17(27(31(20,2)28(16)37)26-21(33)8-7-9-23(26)40-3)11-12-18-25(19)30(39)32(29(18)38)13-6-4-5-10-24(35)36/h7-9,11,14,18-20,25,27,33H,4-6,10,12-13,15H2,1-3H3,(H,35,36)/t18-,19+,20-,25-,27+,31+/m0/s1 |
| InChIKey | YVAWXTGDRDGSOR-OLEXZZJASA-N |
| XLogP | 3.80 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.62 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|