C27H29NO7 — CID 6666443
(3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2,6a,8-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone (PubChem CID 6666443) has the molecular formula C27H29NO7 and a molecular weight of 479.53 g/mol. Its IUPAC name is (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2,6a,8-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone.
| Compound Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2,6a,8-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
|---|---|
| PubChem CID | 6666443 |
| Molecular Formula | C27H29NO7 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-2,6a,8-trimethyl-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[6,7-e]isoindole-1,3,7,10-tetrone |
| SMILES | COc1cc(O)cc(OC)c1[C@H]1C2=CC[C@@H]3C(=O)N(C)C(=O)[C@@H]3[C@@H]2C[C@H]2C(=O)C=C(C)C(=O)[C@@]12C |
| InChI | InChI=1S/C27H29NO7/c1-12-8-18(30)17-11-16-14(6-7-15-21(16)26(33)28(3)25(15)32)23(27(17,2)24(12)31)22-19(34-4)9-13(29)10-20(22)35-5/h6,8-10,15-17,21,23,29H,7,11H2,1-5H3/t15-,16+,17-,21-,23+,27+/m0/s1 |
| InChIKey | LLGRZLCSBLZDRV-CZOZZTIXSA-N |
| XLogP | 2.79 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|