C28H29NO9 — CID 6666508
methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate (PubChem CID 6666508) has the molecular formula C28H29NO9 and a molecular weight of 523.54 g/mol. Its IUPAC name is methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 6666508 |
| Molecular Formula | C28H29NO9 |
| Molecular Weight | 523.54 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | methyl (3aS,6R,6aS,10aR,11aS,11bR)-6-(4-hydroxy-2,6-dimethoxyphenyl)-6a,8-dimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindole-2-carboxylate |
| SMILES | COC(=O)N1C(=O)[C@H]2[C@H](CC=C3[C@H]2C[C@H]2C(=O)C=C(C)C(=O)[C@@]2(C)[C@H]3c2c(OC)cc(O)cc2OC)C1=O |
| InChI | InChI=1S/C28H29NO9/c1-12-8-18(31)17-11-16-14(6-7-15-21(16)26(34)29(25(15)33)27(35)38-5)23(28(17,2)24(12)32)22-19(36-3)9-13(30)10-20(22)37-4/h6,8-10,15-17,21,23,30H,7,11H2,1-5H3/t15-,16+,17-,21-,23+,28+/m0/s1 |
| InChIKey | QQXKMUKFLYNQBD-FTMHDHEQSA-N |
| XLogP | 2.93 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|