C30H32ClNO8 — CID 6666802
4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a,8,9-trimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid (PubChem CID 6666802) has the molecular formula C30H32ClNO8 and a molecular weight of 570.04 g/mol. Its IUPAC name is 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a,8,9-trimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid.
| Compound Name | 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a,8,9-trimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 6666802 |
| Molecular Formula | C30H32ClNO8 |
| Molecular Weight | 570.04 g/mol |
| Exact Mass | 569.18 |
| IUPAC Name | 4-[(3aS,6R,6aS,10aR,11aS,11bR)-6-(3-chloro-4-hydroxy-5-methoxyphenyl)-6a,8,9-trimethyl-1,3,7,10-tetraoxo-4,6,10a,11,11a,11b-hexahydro-3aH-naphtho[2,3-e]isoindol-2-yl]butanoic acid |
| SMILES | COc1cc([C@H]2C3=CC[C@@H]4C(=O)N(CCCC(=O)O)C(=O)[C@@H]4[C@@H]3C[C@H]3C(=O)C(C)=C(C)C(=O)[C@@]23C)cc(Cl)c1O |
| InChI | InChI=1S/C30H32ClNO8/c1-13-14(2)27(37)30(3)19(25(13)35)12-18-16(24(30)15-10-20(31)26(36)21(11-15)40-4)7-8-17-23(18)29(39)32(28(17)38)9-5-6-22(33)34/h7,10-11,17-19,23-24,36H,5-6,8-9,12H2,1-4H3,(H,33,34)/t17-,18+,19-,23-,24-,30+/m0/s1 |
| InChIKey | SUNSVFUHRUVANH-CNHGSEBLSA-N |
| XLogP | 4.06 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.04 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|