C15H20N2O — CID 66671410
4-benzyl-6,9-diazaspiro[4.5]decan-7-one (PubChem CID 66671410) has the molecular formula C15H20N2O and a molecular weight of 244.34 g/mol. Its IUPAC name is 4-benzyl-6,9-diazaspiro[4.5]decan-7-one.
| Compound Name | 4-benzyl-6,9-diazaspiro[4.5]decan-7-one |
|---|---|
| PubChem CID | 66671410 |
| Molecular Formula | C15H20N2O |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.16 |
| IUPAC Name | 4-benzyl-6,9-diazaspiro[4.5]decan-7-one |
| SMILES | O=C1CNCC2(CCCC2Cc2ccccc2)N1 |
| InChI | InChI=1S/C15H20N2O/c18-14-10-16-11-15(17-14)8-4-7-13(15)9-12-5-2-1-3-6-12/h1-3,5-6,13,16H,4,7-11H2,(H,17,18) |
| InChIKey | WLMRSYQRASNHBL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |