C16H22BrNO2S — CID 66672731
propan-2-yl 4-[(4-bromophenyl)sulfanylmethyl]piperidine-1-carboxylate (PubChem CID 66672731) has the molecular formula C16H22BrNO2S and a molecular weight of 372.33 g/mol. Its IUPAC name is propan-2-yl 4-[(4-bromophenyl)sulfanylmethyl]piperidine-1-carboxylate.
| Compound Name | propan-2-yl 4-[(4-bromophenyl)sulfanylmethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 66672731 |
| Molecular Formula | C16H22BrNO2S |
| Molecular Weight | 372.33 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | propan-2-yl 4-[(4-bromophenyl)sulfanylmethyl]piperidine-1-carboxylate |
| SMILES | CC(C)OC(=O)N1CCC(CSc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H22BrNO2S/c1-12(2)20-16(19)18-9-7-13(8-10-18)11-21-15-5-3-14(17)4-6-15/h3-6,12-13H,7-11H2,1-2H3 |
| InChIKey | UZJUOJILZVFANV-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.33 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |