C19H23N5O3 — CID 66676514
2-(2-amino-3-carbamoylpyrido[2,3-b]indol-9-yl)ethyl-tert-butylcarbamic acid (PubChem CID 66676514) has the molecular formula C19H23N5O3 and a molecular weight of 369.43 g/mol. Its IUPAC name is 2-(2-amino-3-carbamoylpyrido[2,3-b]indol-9-yl)ethyl-tert-butylcarbamic acid.
| Compound Name | 2-(2-amino-3-carbamoylpyrido[2,3-b]indol-9-yl)ethyl-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 66676514 |
| Molecular Formula | C19H23N5O3 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 2-(2-amino-3-carbamoylpyrido[2,3-b]indol-9-yl)ethyl-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(CCn1c2ccccc2c2cc(C(N)=O)c(N)nc21)C(=O)O |
| InChI | InChI=1S/C19H23N5O3/c1-19(2,3)24(18(26)27)9-8-23-14-7-5-4-6-11(14)12-10-13(16(21)25)15(20)22-17(12)23/h4-7,10H,8-9H2,1-3H3,(H2,20,22)(H2,21,25)(H,26,27) |
| InChIKey | WPUKMYUAROBWPW-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 127.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |