C22H21N5O — CID 89341066
9-(2-aminoprop-2-enyl)-2-(benzylamino)pyrido[2,3-b]indole-3-carboxamide (PubChem CID 89341066) has the molecular formula C22H21N5O and a molecular weight of 371.44 g/mol. Its IUPAC name is 9-(2-aminoprop-2-enyl)-2-(benzylamino)pyrido[2,3-b]indole-3-carboxamide.
| Compound Name | 9-(2-aminoprop-2-enyl)-2-(benzylamino)pyrido[2,3-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 89341066 |
| Molecular Formula | C22H21N5O |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | 9-(2-aminoprop-2-enyl)-2-(benzylamino)pyrido[2,3-b]indole-3-carboxamide |
| SMILES | C=C(N)Cn1c2ccccc2c2cc(C(N)=O)c(NCc3ccccc3)nc21 |
| InChI | InChI=1S/C22H21N5O/c1-14(23)13-27-19-10-6-5-9-16(19)17-11-18(20(24)28)21(26-22(17)27)25-12-15-7-3-2-4-8-15/h2-11H,1,12-13,23H2,(H2,24,28)(H,25,26) |
| InChIKey | NMLVCULTENEEMB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 98.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |