C22H22N4O2 — CID 143530164
2-amino-9-(3-phenylmethoxypropyl)pyrido[2,3-b]indole-3-carboxamide (PubChem CID 143530164) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-amino-9-(3-phenylmethoxypropyl)pyrido[2,3-b]indole-3-carboxamide.
| Compound Name | 2-amino-9-(3-phenylmethoxypropyl)pyrido[2,3-b]indole-3-carboxamide |
|---|---|
| PubChem CID | 143530164 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 2-amino-9-(3-phenylmethoxypropyl)pyrido[2,3-b]indole-3-carboxamide |
| SMILES | NC(=O)c1cc2c3ccccc3n(CCCOCc3ccccc3)c2nc1N |
| InChI | InChI=1S/C22H22N4O2/c23-20-18(21(24)27)13-17-16-9-4-5-10-19(16)26(22(17)25-20)11-6-12-28-14-15-7-2-1-3-8-15/h1-5,7-10,13H,6,11-12,14H2,(H2,23,25)(H2,24,27) |
| InChIKey | GIQYSMOKQIKGTE-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|