C20H24N2 — CID 66684752
2,9-dibutyl-1,7-phenanthroline (PubChem CID 66684752) has the molecular formula C20H24N2 and a molecular weight of 292.43 g/mol. Its IUPAC name is 2,9-dibutyl-1,7-phenanthroline.
| Compound Name | 2,9-dibutyl-1,7-phenanthroline |
|---|---|
| PubChem CID | 66684752 |
| Molecular Formula | C20H24N2 |
| Molecular Weight | 292.43 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2,9-dibutyl-1,7-phenanthroline |
| SMILES | CCCCc1cnc2ccc3ccc(CCCC)nc3c2c1 |
| InChI | InChI=1S/C20H24N2/c1-3-5-7-15-13-18-19(21-14-15)12-10-16-9-11-17(8-6-4-2)22-20(16)18/h9-14H,3-8H2,1-2H3 |
| InChIKey | XLGYPMXXINBAIB-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.43 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|