C13H13Br2N — CID 11810047
6,8-dibromo-2-butylquinoline (PubChem CID 11810047) has the molecular formula C13H13Br2N and a molecular weight of 343.06 g/mol. Its IUPAC name is 6,8-dibromo-2-butylquinoline.
| Compound Name | 6,8-dibromo-2-butylquinoline |
|---|---|
| PubChem CID | 11810047 |
| Molecular Formula | C13H13Br2N |
| Molecular Weight | 343.06 g/mol |
| Exact Mass | 340.94 |
| IUPAC Name | 6,8-dibromo-2-butylquinoline |
| SMILES | CCCCc1ccc2cc(Br)cc(Br)c2n1 |
| InChI | InChI=1S/C13H13Br2N/c1-2-3-4-11-6-5-9-7-10(14)8-12(15)13(9)16-11/h5-8H,2-4H2,1H3 |
| InChIKey | SBZJZEZPKVGEHD-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.06 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |